| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 1,3,5-Norcaratriene |
|---|---|
| Synonyms | Bicyclo(4.1.0)Hepta-1,3,5-Triene; 1,3,5-Norcaratriene; Inchi=1/C7h6/C1-2-4-7-5-6(7)3-1/H1-4H,5H |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6 |
| Molecular Weight | 90.12 |
| CAS Registry Number | 4646-69-9 |
| SMILES | C1=CC=CC2=C1C2 |
| InChI | 1S/C7H6/c1-2-4-7-5-6(7)3-1/h1-4H,5H2 |
| InChIKey | AMSMVCOBCOZLEE-UHFFFAOYSA-N |
| Density | 1.085g/cm3 (Cal.) |
|---|---|
| Boiling point | 150.921°C at 760 mmHg (Cal.) |
| Flash point | 30.074°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,5-Norcaratriene |