| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | (3R)-6,8a-Dimethyl-3-Propan-2-Yl-1,2,3,4,5,8-Hexahydroazulen-3a-Ol |
|---|---|
| Synonyms | (3R,3As,8Ar)-3-Isopropyl-6,8A-Dimethyl-1,2,3,4,5,8-Hexahydroazulen-3A-Ol; C09628 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 |
| CAS Registry Number | 465-28-1 |
| SMILES | [C@@]12([C@](CC[C@@H]1C(C)C)(CC=C(CC2)C)C)O |
| InChI | 1S/C15H26O/c1-11(2)13-7-9-14(4)8-5-12(3)6-10-15(13,14)16/h5,11,13,16H,6-10H2,1-4H3/t13-,14+,15+/m1/s1 |
| InChIKey | XZYQCFABZDVOPN-ILXRZTDVSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.8±29.0°C at 760 mmHg (Cal.) |
| Flash point | 126.1±16.5°C (Cal.) |
| (1) | Sridhar Soundharrajan Radhakrishanan, Rajagopal R. Velusamy, Rajavel Ramasamy, Masilamani Selladurai, Narasimhan Srinivasan. Antifungal Activity of Some Essential Oils, Journal of Agricultural and Food Chemistry, 2003 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (3R)-6,8a-Dimethyl-3-Propan-2-Yl-1,2,3,4,5,8-Hexahydroazulen-3a-Ol |