|
CAS#: 466-80-8 Product: alpha-Erythroidine No suppilers available for the product. |
| Name | alpha-Erythroidine |
|---|---|
| Synonyms | Alpha-Erythroidine |
| Molecular Structure | ![]() |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 |
| CAS Registry Number | 466-80-8 |
| SMILES | [C@]234C1=CC(OC[C@H]1CCN2CC=C3C=C[C@@H](C4)OC)=O |
| InChI | 1S/C16H19NO3/c1-19-13-3-2-12-5-7-17-6-4-11-10-20-15(18)8-14(11)16(12,17)9-13/h2-3,5,8,11,13H,4,6-7,9-10H2,1H3/t11-,13+,16+/m1/s1 |
| InChIKey | IXPDLJKEPLTCOU-FFSVYQOJSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 522.0±50.0°C at 760 mmHg (Cal.) |
| Flash point | 269.5±30.1°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for alpha-Erythroidine |