Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (1R,2S)-N,N-Diethyl-2-Methylcyclopropanecarboxamide |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 |
| CAS Registry Number | 467426-62-6 |
| SMILES | CCN(CC)C(=O)[C@@H]1C[C@@H]1C |
| InChI | 1S/C9H17NO/c1-4-10(5-2)9(11)8-6-7(8)3/h7-8H,4-6H2,1-3H3/t7-,8+/m0/s1 |
| InChIKey | ZMPWLYHZKNHZBN-JGVFFNPUSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 234.5±7.0°C at 760 mmHg (Cal.) |
| Flash point | 94.8±9.4°C (Cal.) |
| Refractive index | 1.475 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2S)-N,N-Diethyl-2-Methylcyclopropanecarboxamide |