Online Database of Chemicals from Around the World
|
CAS#: 468-22-4 Product: Epibuphanisine No suppilers available for the product. |
| Name | Epibuphanisine |
|---|---|
| Synonyms | Buphanisin; Buphanisine; Crinan, 1,2-Didehydro-3-Methoxy-, (3.Alpha.)- |
| Molecular Structure |  |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 |
| CAS Registry Number | 468-22-4 |
| SMILES | [C@]345C1=C(C=C2C(=C1)OCO2)CN([C@@H]3CC(C=C4)OC)CC5 |
| InChI | 1S/C17H19NO3/c1-19-12-2-3-17-4-5-18(16(17)7-12)9-11-6-14-15(8-13(11)17)21-10-20-14/h2-3,6,8,12,16H,4-5,7,9-10H2,1H3/t12?,16-,17-/m1/s1 |
| InChIKey | HATSAIPBKRRCME-RIJFORKLSA-N |
| Density | 1.334g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.086°C at 760 mmHg (Cal.) |
| Flash point | 126.988°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Epibuphanisine |