|
CAS#: 469-22-7 Product: Eseroline No suppilers available for the product. |
| Name | Eseroline |
|---|---|
| Synonyms | Ncgc00142536-01; (3As-Cis)-1,2,3,3A,8,8A-Hexahydro-1,3A,8-Trimethylpyrrolo(2,3-B)Indol-5-Ol; Eseroline |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 |
| CAS Registry Number | 469-22-7 |
| SMILES | [C@@H]12N(C3=C([C@@]1(CCN2C)C)C=C(O)C=C3)C |
| InChI | 1S/C13H18N2O/c1-13-6-7-14(2)12(13)15(3)11-5-4-9(16)8-10(11)13/h4-5,8,12,16H,6-7H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | HKGWQUVGHPDEBZ-OLZOCXBDSA-N |
| Density | 1.161g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.341°C at 760 mmHg (Cal.) |
| Flash point | 189.619°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Eseroline |