Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl 1H-Indol-5-Ylcarbamate |
|---|---|
| Synonyms | methyl 1H-indol-5-ylcarbamate |
| Molecular Structure |  |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 |
| CAS Registry Number | 470454-96-7 |
| SMILES | COC(=O)Nc1ccc2c(c1)cc[nH]2 |
| InChI | 1S/C10H10N2O2/c1-14-10(13)12-8-2-3-9-7(6-8)4-5-11-9/h2-6,11H,1H3,(H,12,13) |
| InChIKey | ZBWDFSJBRLLLSO-UHFFFAOYSA-N |
| Density | 1.346g/cm3 (Cal.) |
|---|---|
| Boiling point | 324.328°C at 760 mmHg (Cal.) |
| Flash point | 149.948°C (Cal.) |
| Refractive index | 1.699 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 1H-Indol-5-Ylcarbamate |