| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | Styrylphosphonic Dichloride |
|---|---|
| Synonyms | [(E)-2-Dichlorophosphorylvinyl]Benzene; Styrylphosphonic Dichloride |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7Cl2OP |
| Molecular Weight | 221.02 |
| CAS Registry Number | 4708-07-0 |
| EINECS | 225-196-7 |
| SMILES | C1=C(/C=C/[P](=O)(Cl)Cl)C=CC=C1 |
| InChI | 1S/C8H7Cl2OP/c9-12(10,11)7-6-8-4-2-1-3-5-8/h1-7H/b7-6+ |
| InChIKey | JZCWUZUUPGUVRB-VOTSOKGWSA-N |
| Density | 1.374g/cm3 (Cal.) |
|---|---|
| Boiling point | 317.993°C at 760 mmHg (Cal.) |
| Flash point | 146.117°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Styrylphosphonic Dichloride |