Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Ethyl (2S)-4-Methylene-2-Piperidinecarboxylate |
|---|---|
| Synonyms | (S)-ethyl 4-methylenepiperidine-2-carboxylate |
| Molecular Structure |  |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 |
| CAS Registry Number | 471864-40-1 |
| SMILES | CCOC(=O)[C@@H]1CC(=C)CCN1 |
| InChI | 1S/C9H15NO2/c1-3-12-9(11)8-6-7(2)4-5-10-8/h8,10H,2-6H2,1H3/t8-/m0/s1 |
| InChIKey | YQAYGKZBWSWHLX-QMMMGPOBSA-N |
| Density | 1.021g/cm3 (Cal.) |
|---|---|
| Boiling point | 224.294°C at 760 mmHg (Cal.) |
| Flash point | 89.45°C (Cal.) |
| Refractive index | 1.475 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (2S)-4-Methylene-2-Piperidinecarboxylate |