| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-(2-Pyridinyl)-1-Propen-1-One |
|---|---|
| Synonyms | 1-Propen-1-one, 2-(2-pyridinyl)-; 2-(pyridin-2-yl)prop-1-en-1-one; InChI=1/C8H7NO/c1-7(6-10)8-4-2-3-5-9-8/h2-5H,1H3 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7NO |
| Molecular Weight | 133.15 |
| CAS Registry Number | 473775-05-2 |
| SMILES | CC(=C=O)C1=CC=CC=N1 |
| InChI | 1S/C8H7NO/c1-7(6-10)8-4-2-3-5-9-8/h2-5H,1H3 |
| InChIKey | NLFCHCOYYYYGSG-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 190.4±9.0°C at 760 mmHg (Cal.) |
| Flash point | 69.4±25.1°C (Cal.) |
| Refractive index | 1.515 (Cal.) |
| (1) | Carsten Plüg, Arvid Kuhn and Curt Wentrup. Quinolizine-2,4-diones by reversible dimerisation 2-pyridylketenes, J. Chem. Soc., Perkin Trans. 1, 2002, 0, 1366. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-(2-Pyridinyl)-1-Propen-1-One |