Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Amino-6-Ethoxy-1H-Isoindole-5-Carboxamide |
|---|---|
| Synonyms | 3-amino-6-ethoxy-1H-isoindole-5-carboxamide |
| Molecular Structure |  |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 |
| CAS Registry Number | 474554-90-0 |
| SMILES | NC(=O)c1cc2C(/N)=N\Cc2cc1OCC |
| InChI | 1S/C11H13N3O2/c1-2-16-9-3-6-5-14-10(12)7(6)4-8(9)11(13)15/h3-4H,2,5H2,1H3,(H2,12,14)(H2,13,15) |
| InChIKey | PFKWKVAMYYHBLV-UHFFFAOYSA-N |
| Density | 1.425g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.074°C at 760 mmHg (Cal.) |
| Flash point | 187.291°C (Cal.) |
| Refractive index | 1.664 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Amino-6-Ethoxy-1H-Isoindole-5-Carboxamide |