Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2,5-Diisopropyl-1,3-Cyclopentadiene |
|---|---|
| Synonyms | 2,5-diisopropylcyclopenta-1,3-diene |
| Molecular Structure |  |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 |
| CAS Registry Number | 474972-16-2 |
| SMILES | C\1=C\C(=C/C/1C(C)C)C(C)C |
| InChI | 1S/C11H18/c1-8(2)10-5-6-11(7-10)9(3)4/h5-10H,1-4H3 |
| InChIKey | FDTFPKDWVZSIHD-UHFFFAOYSA-N |
| Density | 0.846g/cm3 (Cal.) |
|---|---|
| Boiling point | 186.683°C at 760 mmHg (Cal.) |
| Flash point | 54.379°C (Cal.) |
| Refractive index | 1.475 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Diisopropyl-1,3-Cyclopentadiene |