|
CAS#: 475-64-9 Product: Bisanthone No suppilers available for the product. |
| Name | Bisanthone |
|---|---|
| Synonyms | Aids-002048; Aids002048; Phenanthro[1,10,9,8-O,P,Q,R,A]Perylene-7,10-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C28H12O2 |
| Molecular Weight | 380.40 |
| CAS Registry Number | 475-64-9 |
| SMILES | C1=CC=C7C2=C1C(C6=C5C2=C3C8=C(C(C4=C3C(=CC=C4)C5=CC=C6)=O)C=CC=C78)=O |
| InChI | 1S/C28H12O2/c29-27-17-9-1-5-13-14-6-2-11-19-22(14)26-24-16(8-4-12-20(24)28(19)30)15-7-3-10-18(27)23(15)25(26)21(13)17/h1-12H |
| InChIKey | LEEJQTWXRMXYIB-UHFFFAOYSA-N |
| Density | 1.583g/cm3 (Cal.) |
|---|---|
| Boiling point | 733.631°C at 760 mmHg (Cal.) |
| Flash point | 258.926°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bisanthone |