Online Database of Chemicals from Around the World
|
CAS#: 47562-08-3 Product: Lorajmine No suppilers available for the product. |
| Name | Lorajmine |
|---|---|
| Synonyms | Ajmalan-17,21-Diol, 17-(Chloroacetate); Lorajmine |
| Molecular Structure |  |
| Molecular Formula | C22H27ClN2O3 |
| Molecular Weight | 402.92 |
| CAS Registry Number | 47562-08-3 |
| EINECS | 256-322-9 |
| SMILES | [C@]156[C@@H](N(C2=CC=CC=C12)C)[C@H]3N4[C@H](C(C(C3)[C@@H]([C@H]4O)CC)C5C(OCCl)=O)C6 |
| InChI | 1S/C22H27ClN2O3/c1-3-11-12-8-15-19-22(13-6-4-5-7-14(13)24(19)2)9-16(25(15)20(11)26)17(12)18(22)21(27)28-10-23/h4-7,11-12,15-20,26H,3,8-10H2,1-2H3/t11-,12?,15-,16-,17?,18?,19-,20+,22-/m0/s1 |
| InChIKey | RBXRLORHKVPADF-VHQNAJMPSA-N |
| Density | 1.404g/cm3 (Cal.) |
|---|---|
| Boiling point | 535.51°C at 760 mmHg (Cal.) |
| Flash point | 277.667°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lorajmine |