Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1-(4-Nitro-1H-Indol-3-Yl)Ethanone |
|---|---|
| Synonyms | 1-(4-Nitro-1h-indol-3-yl)-ethanone; 1-(4-NITRO-1H-INDOL-3-YL)ETHANONE |
| Molecular Structure |  |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.18 |
| CAS Registry Number | 4769-95-3 |
| SMILES | [O-][N+](=O)c1cccc2c1c(cn2)C(=O)C |
| InChI | 1S/C10H8N2O3/c1-6(13)7-5-11-8-3-2-4-9(10(7)8)12(14)15/h2-5,11H,1H3 |
| InChIKey | CXTPOLDUEGJFDZ-UHFFFAOYSA-N |
| Density | 1.406g/cm3 (Cal.) |
|---|---|
| Boiling point | 429.119°C at 760 mmHg (Cal.) |
| Flash point | 213.324°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Nitro-1H-Indol-3-Yl)Ethanone |