Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Cinnofuradione |
|---|---|
| Synonyms | Cinnofuradione; Cinnofuradione [Inn] |
| Molecular Structure |  |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.37 |
| CAS Registry Number | 477-80-5 |
| SMILES | C1=CC=CC2=C1N4N(C3=C2C=CC=C3)C(=O)C(C4=O)CC5CCCO5 |
| InChI | 1S/C20H18N2O3/c23-19-16(12-13-6-5-11-25-13)20(24)22-18-10-4-2-8-15(18)14-7-1-3-9-17(14)21(19)22/h1-4,7-10,13,16H,5-6,11-12H2 |
| InChIKey | MTRUDCIZADOOBK-UHFFFAOYSA-N |
| Density | 1.406g/cm3 (Cal.) |
|---|---|
| Boiling point | 529.41°C at 760 mmHg (Cal.) |
| Flash point | 273.977°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cinnofuradione |