| Shanghai Worldyang Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.worldyachem.com | |||
![]() | +86 13651600618 +86 (21) 5679-5779 | |||
![]() | +86 (21) 5679-5266 | |||
![]() | sales7777@worldyachem.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 13651600618 | |||
![]() | WhatsApp:+86 13651600618 | |||
| Chemical manufacturer since 2012 | ||||
| Name | 4-(Ethoxymethoxy)-5,5,5-trifluoro-4-(trifluoromethyl)pent-1-ene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H12F6O2 |
| Molecular Weight | 266.18 |
| CAS Registry Number | 477199-90-9 |
| SMILES | CCOCOC(CC=C)(C(F)(F)F)C(F)(F)F |
|
4-(Ethoxymethoxy)-5,5,5-trifluoro-4-(trifluoromethyl)pent-1-ene is a chemical compound with a unique structure and multiple applications in industrial and research settings. This compound, with the molecular formula C9H7F6O3, has unique chemical properties and has application value in multiple fields. The discovery and synthesis of 4-(ethoxymethoxy)-5,5,5-trifluoro-4-(trifluoromethyl)pent-1-ene involved specialized methods to introduce specific functional groups into the pentene backbone. The researchers achieved this through a synthetic route that combined fluoroalkylation and etherification techniques. The starting materials included fluorinated and ether-containing precursors to achieve the desired structure and properties. 4-(Ethoxymethoxy)-5,5,5-trifluoro-4-(trifluoromethyl)pent-1-ene is characterized by substitution of the pentene backbone with trifluoromethyl (-CF3), trifluoromethyl ether (-OCF3), and ethoxymethoxy (-OCH2OCH3). This combination of substituents imparts specific chemical and physical properties to the compound, influencing its application in various industries. 4-(Ethoxymethoxy)-5,5,5-trifluoro-4-(trifluoromethyl)pent-1-ene is an important building block for the synthesis of fluorinated organic compounds. Its trifluoromethyl group enhances chemical stability and alters molecular interactions, making it useful for the development of advanced materials and pharmaceutical intermediates. Compounds containing fluorinated structures, such as 4-(Ethoxymethoxy)-5,5,5-trifluoro-4-(trifluoromethyl)pent-1-ene, are being studied as active ingredients in agrochemicals due to their enhanced biological activity and metabolic stability. In pharmaceutical research, fluorinated molecules are intensively studied for their ability to improve drug potency, metabolic resistance, and target specificity. Derivatives of fluorinated compounds can be used as specialty solvents or surfactants in industrial applications. Their unique chemical properties often improve the performance of specific formulations and processes. In the research field, compounds such as 4-(ethoxymethoxy)-5,5,5-trifluoro-4-(trifluoromethyl)pent-1-ene can be used as chemical probes or standards for analytical techniques. They help identify, quantify, and characterize related compounds in complex mixtures. References none |
| Market Analysis Reports |
| List of Reports Available for 4-(Ethoxymethoxy)-5,5,5-trifluoro-4-(trifluoromethyl)pent-1-ene |