Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N-Cyclopropyl-N-Methyl-D-Prolinamide |
|---|---|
| Synonyms | (R)-N-cyclopropyl-N-methylpyrrolidine-2-carboxamide |
| Molecular Structure |  |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 |
| CAS Registry Number | 477577-13-2 |
| SMILES | CN(C1CC1)C(=O)[C@H]2CCCN2 |
| InChI | 1S/C9H16N2O/c1-11(7-4-5-7)9(12)8-3-2-6-10-8/h7-8,10H,2-6H2,1H3/t8-/m1/s1 |
| InChIKey | PINWSZKBKVKKMW-MRVPVSSYSA-N |
| Density | 1.102g/cm3 (Cal.) |
|---|---|
| Boiling point | 298.17°C at 760 mmHg (Cal.) |
| Flash point | 134.129°C (Cal.) |
| Refractive index | 1.531 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Cyclopropyl-N-Methyl-D-Prolinamide |