|
CAS#: 478698-32-7 Product: 4,4-Difluoro-3,3-Dimethyl-1-{[(2-Methyl-2-Propanyl)Oxy]Carbonyl}-L-Proline No suppilers available for the product. |
| Name | 4,4-Difluoro-3,3-Dimethyl-1-{[(2-Methyl-2-Propanyl)Oxy]Carbonyl}-L-Proline |
|---|---|
| Synonyms | (2S)-1,2- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H19F2NO4 |
| Molecular Weight | 279.28 |
| CAS Registry Number | 478698-32-7 |
| SMILES | O=C(OC(C)(C)C)N1[C@H](C(=O)O)C(C(F)(F)C1)(C)C |
| InChI | 1S/C12H19F2NO4/c1-10(2,3)19-9(18)15-6-12(13,14)11(4,5)7(15)8(16)17/h7H,6H2,1-5H3,(H,16,17)/t7-/m1/s1 |
| InChIKey | BEKSOLPMSVHHRU-SSDOTTSWSA-N |
| Density | 1.244g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.627°C at 760 mmHg (Cal.) |
| Flash point | 164.644°C (Cal.) |
| Refractive index | 1.474 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4,4-Difluoro-3,3-Dimethyl-1-{[(2-Methyl-2-Propanyl)Oxy]Carbonyl}-L-Proline |