Online Database of Chemicals from Around the World
|
CAS#: 4789-40-6 Product: 2,5-Di(Tert-Butyl)Furan No suppilers available for the product. |
| Name | 2,5-Di(Tert-Butyl)Furan |
|---|---|
| Synonyms | Furan, 2,5-Bis(1,1-Dimethylethyl)-; Furan, 2,5-Di-Tert-Butyl- |
| Molecular Structure |  |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 |
| CAS Registry Number | 4789-40-6 |
| SMILES | C1=C(C(C)(C)C)OC(=C1)C(C)(C)C |
| InChI | 1S/C12H20O/c1-11(2,3)9-7-8-10(13-9)12(4,5)6/h7-8H,1-6H3 |
| InChIKey | LHCFPVDATVVDLD-UHFFFAOYSA-N |
| Density | 0.877g/cm3 (Cal.) |
|---|---|
| Boiling point | 209.999°C at 760 mmHg (Cal.) |
| Flash point | 72.058°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Di(Tert-Butyl)Furan |