|
CAS#: 4791-69-9 Product: Ethyl Octahydrospiro[4,7-Methano-5H-Indene-5,2'-Oxirane]-3'-Carboxylate No suppilers available for the product. |
| Name | Ethyl Octahydrospiro[4,7-Methano-5H-Indene-5,2'-Oxirane]-3'-Carboxylate |
|---|---|
| Synonyms | Ethyl Octahydrospiro(4,7-Methano-5H-Indene-5,2'-Oxirane)-3'-Carboxylate |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 |
| CAS Registry Number | 4791-69-9 |
| EINECS | 225-339-3 |
| SMILES | C(OC(C1C2(O1)C3C4C(C(C2)C3)CCC4)=O)C |
| InChI | 1S/C14H20O3/c1-2-16-13(15)12-14(17-12)7-8-6-11(14)10-5-3-4-9(8)10/h8-12H,2-7H2,1H3 |
| InChIKey | GERTUMCUNLMNHD-UHFFFAOYSA-N |
| Density | 1.197g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.548°C at 760 mmHg (Cal.) |
| Flash point | 132.071°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl Octahydrospiro[4,7-Methano-5H-Indene-5,2'-Oxirane]-3'-Carboxylate |