|
CAS#: 4792-18-1 Product: Levoxadrol No suppilers available for the product. |
| Name | Levoxadrol |
|---|---|
| Synonyms | Pdsp1_000675; Pdsp2_000665; Levoxadrol |
| Molecular Structure | ![]() |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 |
| CAS Registry Number | 4792-18-1 |
| SMILES | [C@]3(OC(C1=CC=CC=C1)(C2=CC=CC=C2)OC3)([C@]4(CCCCN4)C)C |
| InChI | 1S/C22H27NO2/c1-20(15-9-10-16-23-20)21(2)17-24-22(25-21,18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-8,11-14,23H,9-10,15-17H2,1-2H3/t20-,21+/m1/s1 |
| InChIKey | LXSFMSNAFNZVIS-RTWAWAEBSA-N |
| Density | 1.087g/cm3 (Cal.) |
|---|---|
| Boiling point | 445.727°C at 760 mmHg (Cal.) |
| Flash point | 194.159°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Levoxadrol |