Online Database of Chemicals from Around the World
|
CAS#: 480-09-1 Product: Rhein-9-Anthrone No suppilers available for the product. |
| Name | Rhein-9-Anthrone |
|---|---|
| Synonyms | 4,5-Dihydroxy-10-Keto-9H-Anthracene-2-Carboxylic Acid; Aids-048397; Aids048397 |
| Molecular Structure |  |
| Molecular Formula | C15H10O5 |
| Molecular Weight | 270.24 |
| CAS Registry Number | 480-09-1 |
| SMILES | C3=C(O)C1=C(CC2=C(C1=O)C(=CC=C2)O)C=C3C(O)=O |
| InChI | 1S/C15H10O5/c16-10-3-1-2-7-4-8-5-9(15(19)20)6-11(17)13(8)14(18)12(7)10/h1-3,5-6,16-17H,4H2,(H,19,20) |
| InChIKey | OZFQHULMMDWMIV-UHFFFAOYSA-N |
| Density | 1.572g/cm3 (Cal.) |
|---|---|
| Boiling point | 602.613°C at 760 mmHg (Cal.) |
| Flash point | 332.275°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Rhein-9-Anthrone |