| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Anthramycin |
|---|---|
| Synonyms | (E)-3-(4,6-Dihydroxy-3-Methyl-11-Oxo-5,6,6A,7-Tetrahydropyrrolo[5,1-C][1,4]Benzodiazepin-8-Yl)Prop-2-Enamide; (E)-3-(4,6-Dihydroxy-11-Keto-3-Methyl-5,6,6A,7-Tetrahydropyrrolo[5,1-C][1,4]Benzodiazepin-8-Yl)Acrylamide; 3-(4,6-Dihydroxy-11-Keto-3-Methyl-5,6,6A,7-Tetrahydropyrrolo[5,1-C][1,4]Benzodiazepin-8-Yl)Acrylamide |
| Molecular Structure | ![]() |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 |
| CAS Registry Number | 4803-27-4 |
| SMILES | C1=CC(=C(C2=C1C(N3C(C(N2)O)CC(=C3)/C=C/C(=O)N)=O)O)C |
| InChI | 1S/C16H17N3O4/c1-8-2-4-10-13(14(8)21)18-15(22)11-6-9(3-5-12(17)20)7-19(11)16(10)23/h2-5,7,11,15,18,21-22H,6H2,1H3,(H2,17,20)/b5-3+ |
| InChIKey | VGQOVCHZGQWAOI-HWKANZROSA-N |
| Density | 1.505g/cm3 (Cal.) |
|---|---|
| Boiling point | 679.872°C at 760 mmHg (Cal.) |
| Flash point | 364.974°C (Cal.) |
| (1) | Liangcheng Du and Lili Lou. PKS and NRPS release mechanisms, Nat. Prod. Rep., 2010, 27, 255. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Anthramycin |