Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-Cyclohexene-1,4-Dicarbonyl Dichloride |
|---|---|
| Synonyms | cyclohex-1-ene-1,4-dicarbonyl dichloride |
| Molecular Structure |  |
| Molecular Formula | C8H8Cl2O2 |
| Molecular Weight | 207.05 |
| CAS Registry Number | 4806-86-4 |
| SMILES | O=C(Cl)C1C\C=C(/CC1)C(Cl)=O |
| InChI | 1S/C8H8Cl2O2/c9-7(11)5-1-2-6(4-3-5)8(10)12/h1,6H,2-4H2 |
| InChIKey | WWHIQFGZIUMLNO-UHFFFAOYSA-N |
| Density | 1.38g/cm3 (Cal.) |
|---|---|
| Boiling point | 282.217°C at 760 mmHg (Cal.) |
| Flash point | 135.797°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Cyclohexene-1,4-Dicarbonyl Dichloride |