Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 17-beta-Ethyletiocholane |
|---|---|
| Synonyms | Pregnane; Chebi:20674; 5Beta-Pregnane |
| Molecular Structure |  |
| Molecular Formula | C21H36 |
| Molecular Weight | 288.52 |
| CAS Registry Number | 481-26-5 |
| SMILES | [C@@]34(C)[C@@H]1[C@H]([C@H]2[C@@](CC1)(C)[C@H](CC2)CC)CC[C@@H]3CCCC4 |
| InChI | 1S/C21H36/c1-4-15-9-11-18-17-10-8-16-7-5-6-13-20(16,2)19(17)12-14-21(15,18)3/h15-19H,4-14H2,1-3H3/t15-,16-,17-,18-,19-,20-,21+/m0/s1 |
| InChIKey | JWMFYGXQPXQEEM-NUNROCCHSA-N |
| Density | 0.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.3±9.0°C at 760 mmHg (Cal.) |
| Flash point | 162.7±12.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 17-beta-Ethyletiocholane |