Online Database of Chemicals from Around the World
|
CAS#: 482-23-5 Product: 3-[3-Oxoisobenzofuran-1(3H)-Ylidene]-1(3H)-Isobenzofuranone No suppilers available for the product. |
| Name | 3-[3-Oxoisobenzofuran-1(3H)-Ylidene]-1(3H)-Isobenzofuranone |
|---|---|
| Synonyms | (3Z)-3-(3-Oxoisobenzofuran-1-Ylidene)Isobenzofuran-1-One; (3Z)-3-(3-Oxo-1-Isobenzofuranylidene)-1-Isobenzofuranone; (3Z)-3-(3-Ketoisobenzofuran-1-Ylidene)Isobenzofuran-1-One |
| Molecular Structure | ![CAS#: 482-23-5， 3-[3-Oxoisobenzofuran-1(3H)-Ylidene]-1(3H)-Isobenzofuranone](/moreStructures/482-23-5.gif) |
| Molecular Formula | C16H8O4 |
| Molecular Weight | 264.24 |
| CAS Registry Number | 482-23-5 |
| SMILES | C4=C3\C(=C/1OC(C2=CC=CC=C12)=O)OC(C3=CC=C4)=O |
| InChI | 1S/C16H8O4/c17-15-11-7-3-1-5-9(11)13(19-15)14-10-6-2-4-8-12(10)16(18)20-14/h1-8H/b14-13- |
| InChIKey | BABBLZNSSDFZFH-YPKPFQOOSA-N |
| Density | 1.509g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.303°C at 760 mmHg (Cal.) |
| Flash point | 230.262°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[3-Oxoisobenzofuran-1(3H)-Ylidene]-1(3H)-Isobenzofuranone |