|
CAS#: 482306-17-2 Product: 5-Chloro-N-[3-[[3-Cyano-4-(3-Oxomorpholin-4-Yl)Phenyl]Amino]-2-Hydroxy-Propyl]Thiophene-2-Carboxamide No suppilers available for the product. |
| Name | 5-Chloro-N-[3-[[3-Cyano-4-(3-Oxomorpholin-4-Yl)Phenyl]Amino]-2-Hydroxy-Propyl]Thiophene-2-Carboxamide |
|---|---|
| Synonyms | 2-Thiophe |
| Molecular Structure | ![]() |
| Molecular Formula | C19H19ClN4O4S |
| Molecular Weight | 434.90 |
| CAS Registry Number | 482306-17-2 |
| SMILES | O=C(NCC(O)CNc1cc(C#N)c(cc1)N2CCOCC2=O)c3ccc(Cl)s3 |
| InChI | 1S/C19H19ClN4O4S/c20-17-4-3-16(29-17)19(27)23-10-14(25)9-22-13-1-2-15(12(7-13)8-21)24-5-6-28-11-18(24)26/h1-4,7,14,22,25H,5-6,9-11H2,(H,23,27) |
| InChIKey | YSUPIIJSHZYYHO-UHFFFAOYSA-N |
| Density | 1.491g/cm3 (Cal.) |
|---|---|
| Boiling point | 821.616°C at 760 mmHg (Cal.) |
| Flash point | 450.697°C (Cal.) |
| Refractive index | 1.667 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-N-[3-[[3-Cyano-4-(3-Oxomorpholin-4-Yl)Phenyl]Amino]-2-Hydroxy-Propyl]Thiophene-2-Carboxamide |