|
CAS#: 482306-20-7 Product: 5-Chloro-N-[3-[[3,5-Dimethyl-4-(3-Oxomorpholin-4-Yl)Phenyl]Amino]-2-Hydroxy-Propyl]Thiophene-2-Carboxamide No suppilers available for the product. |
| Name | 5-Chloro-N-[3-[[3,5-Dimethyl-4-(3-Oxomorpholin-4-Yl)Phenyl]Amino]-2-Hydroxy-Propyl]Thiophene-2-Carboxamide |
|---|---|
| Synonyms | 2-Thiophe |
| Molecular Structure | ![]() |
| Molecular Formula | C20H24ClN3O4S |
| Molecular Weight | 437.94 |
| CAS Registry Number | 482306-20-7 |
| SMILES | O=C(NCC(O)CNc2cc(C)c(N1CCOCC1=O)c(C)c2)c3ccc(Cl)s3 |
| InChI | 1S/C20H24ClN3O4S/c1-12-7-14(8-13(2)19(12)24-5-6-28-11-18(24)26)22-9-15(25)10-23-20(27)16-3-4-17(21)29-16/h3-4,7-8,15,22,25H,5-6,9-11H2,1-2H3,(H,23,27) |
| InChIKey | USBPTPDPYDHXRE-UHFFFAOYSA-N |
| Density | 1.376g/cm3 (Cal.) |
|---|---|
| Boiling point | 806.36°C at 760 mmHg (Cal.) |
| Flash point | 441.471°C (Cal.) |
| Refractive index | 1.64 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-N-[3-[[3,5-Dimethyl-4-(3-Oxomorpholin-4-Yl)Phenyl]Amino]-2-Hydroxy-Propyl]Thiophene-2-Carboxamide |