|
CAS#: 482308-08-7 Product: 4-[4-Amino-2-(Trifluoromethyl)Phenyl]Morpholin-3-One No suppilers available for the product. |
| Name | 4-[4-Amino-2-(Trifluoromethyl)Phenyl]Morpholin-3-One |
|---|---|
| Synonyms | 3-Morpholinone, 4-[4-amino-2-(trifluoromethyl)phenyl]- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11F3N2O2 |
| Molecular Weight | 260.21 |
| CAS Registry Number | 482308-08-7 |
| SMILES | FC(F)(F)c1cc(N)ccc1N2CCOCC2=O |
| InChI | 1S/C11H11F3N2O2/c12-11(13,14)8-5-7(15)1-2-9(8)16-3-4-18-6-10(16)17/h1-2,5H,3-4,6,15H2 |
| InChIKey | VSBLPKFRZOWFSZ-UHFFFAOYSA-N |
| Density | 1.406g/cm3 (Cal.) |
|---|---|
| Boiling point | 481.921°C at 760 mmHg (Cal.) |
| Flash point | 245.257°C (Cal.) |
| Refractive index | 1.532 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[4-Amino-2-(Trifluoromethyl)Phenyl]Morpholin-3-One |