|
CAS#: 482308-12-3 Product: 4-(4-Amino-2,6-Dimethyl-Phenyl)Morpholin-3-One No suppilers available for the product. |
| Name | 4-(4-Amino-2,6-Dimethyl-Phenyl)Morpholin-3-One |
|---|---|
| Synonyms | 3-Morpholinone, 4-(4-amino-2,6-dimethylphenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 |
| CAS Registry Number | 482308-12-3 |
| SMILES | Cc2cc(N)cc(C)c2N1CCOCC1=O |
| InChI | 1S/C12H16N2O2/c1-8-5-10(13)6-9(2)12(8)14-3-4-16-7-11(14)15/h5-6H,3-4,7,13H2,1-2H3 |
| InChIKey | KPPNUQUMJMBCKB-UHFFFAOYSA-N |
| Density | 1.197g/cm3 (Cal.) |
|---|---|
| Boiling point | 522.898°C at 760 mmHg (Cal.) |
| Flash point | 270.039°C (Cal.) |
| Refractive index | 1.589 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-Amino-2,6-Dimethyl-Phenyl)Morpholin-3-One |