Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 6-Amino-1,3-Di-2-Propen-1-Yl-2,4(1H,3H)-Pyrimidinedione |
|---|---|
| Synonyms | 1,3-Diallyl-6-Amino-Pyrimidine-2,4-Dione; 1,3-Diallyl-6-Aminopyrimidine-2,4-Dione; 1,3-Diallyl-6-Amino-Pyrimidine-2,4-Quinone |
| Molecular Structure |  |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 |
| CAS Registry Number | 4852-19-1 |
| EINECS | 225-444-4 |
| SMILES | C(N1C(=O)N(C(=CC1=O)N)CC=C)C=C |
| InChI | 1S/C10H13N3O2/c1-3-5-12-8(11)7-9(14)13(6-4-2)10(12)15/h3-4,7H,1-2,5-6,11H2 |
| InChIKey | FWOKREPUUOLKNQ-UHFFFAOYSA-N |
| Density | 1.159g/cm3 (Cal.) |
|---|---|
| Boiling point | 308.916°C at 760 mmHg (Cal.) |
| Flash point | 140.628°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Amino-1,3-Di-2-Propen-1-Yl-2,4(1H,3H)-Pyrimidinedione |