Online Database of Chemicals from Around the World
|
CAS#: 486-71-5 Product: 1-Epilupinine No suppilers available for the product. |
| Name | 1-Epilupinine |
|---|---|
| Synonyms | [(1S,9Ar)-Quinolizidin-1-Yl]Methanol; (1S-Cis)-Octahydro-2H-Quinolizine-1-Methanol |
| Molecular Structure |  |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 |
| CAS Registry Number | 486-71-5 |
| SMILES | [C@H]12N(CCC[C@@H]1CO)CCCC2 |
| InChI | 1S/C10H19NO/c12-8-9-4-3-7-11-6-2-1-5-10(9)11/h9-10,12H,1-8H2/t9-,10-/m1/s1 |
| InChIKey | HDVAWXXJVMJBAR-NXEZZACHSA-N |
| Density | 1.046g/cm3 (Cal.) |
|---|---|
| Boiling point | 269.999°C at 760 mmHg (Cal.) |
| Flash point | 99.124°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Epilupinine |