|
CAS#: 4865-85-4 Product: Ochratoxin C No suppilers available for the product. |
| Name | Ochratoxin C |
|---|---|
| Synonyms | Ethyl (2S)-2-[[(3R)-5-Chloro-8-Hydroxy-3-Methyl-1-Oxo-Isochroman-7-Carbonyl]Amino]-3-Phenyl-Propanoate; (2S)-2-[[[(3R)-5-Chloro-8-Hydroxy-3-Methyl-1-Oxo-7-Isochromanyl]-Oxomethyl]Amino]-3-Phenylpropanoic Acid Ethyl Ester; (2S)-2-[[(3R)-5-Chloro-8-Hydroxy-1-Keto-3-Methyl-Isochroman-7-Carbonyl]Amino]-3-Phenyl-Propionic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C22H22ClNO6 |
| Molecular Weight | 431.87 |
| CAS Registry Number | 4865-85-4 |
| SMILES | [C@H](CC1=CC=CC=C1)(C(OCC)=O)NC(C2=C(C3=C(C(=C2)Cl)C[C@H](OC3=O)C)O)=O |
| InChI | 1S/C22H22ClNO6/c1-3-29-21(27)17(10-13-7-5-4-6-8-13)24-20(26)15-11-16(23)14-9-12(2)30-22(28)18(14)19(15)25/h4-8,11-12,17,25H,3,9-10H2,1-2H3,(H,24,26)/t12-,17+/m1/s1 |
| InChIKey | BPZZWRPHVVDAPT-PXAZEXFGSA-N |
| Density | 1.328g/cm3 (Cal.) |
|---|---|
| Boiling point | 612.617°C at 760 mmHg (Cal.) |
| Flash point | 324.299°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Ochratoxin C |