| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | (+)-Proto-Quercitol |
|---|---|
| Synonyms | 1L-1,3,4/2,5-Cyclohexanepentol; Chebi:27371; Quercitol |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12O5 |
| Molecular Weight | 164.16 |
| CAS Registry Number | 488-73-3 |
| SMILES | [C@H]1(C([C@H]([C@H](O)C[C@H]1O)O)O)O |
| InChI | 1S/C6H12O5/c7-2-1-3(8)5(10)6(11)4(2)9/h2-11H,1H2/t2-,3-,4+,5+/m1/s1 |
| InChIKey | IMPKVMRTXBRHRB-MBMOQRBOSA-N |
| Density | 1.8±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 293.6±40.0°C at 760 mmHg (Cal.) |
| Flash point | 146.2±21.9°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Seiichiro Ogawa, Yo Ohishi, Miwako Asada, Akihiro Tomoda, Atsushi Takahashi, Yoriko Ooki, Midori Mori, Masayoshi Itoh and Takashi Korenaga. Convenient synthesis of (+)-valiolamine and (−)-1-epi-valiolamine from (−)-vibo-quercitol, Org. Biomol. Chem., 2004, 2, 884. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (+)-Proto-Quercitol |