Online Database of Chemicals from Around the World
|
CAS#: 490-24-4 Product: Lumicolchicine No suppilers available for the product. |
| Name | Lumicolchicine |
|---|---|
| Synonyms | .Gamma.-Lumicolchicine; Nsc221661; Beta-Lumicolchicine |
| Molecular Structure |  |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 |
| CAS Registry Number | 490-24-4 (6901-14-0) |
| SMILES | C1=C(OC)C(=C(C2=C1CCC(C3=C2C4C3C(=O)C(=C4)OC)NC(=O)C)OC)OC |
| InChI | 1S/C22H25NO6/c1-10(24)23-13-7-6-11-8-15(27-3)21(28-4)22(29-5)16(11)17-12-9-14(26-2)20(25)18(12)19(13)17/h8-9,12-13,18H,6-7H2,1-5H3,(H,23,24) |
| InChIKey | VKPVZFOUXUQJMW-UHFFFAOYSA-N |
| Density | 1.3g/cm3 (Cal.) |
|---|---|
| Boiling point | 623.227°C at 760 mmHg (Cal.) |
| Flash point | 330.716°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lumicolchicine |