|
CAS#: 4922-94-5 Product: 5-(4-Aminophenyl)-1H-1,2,4-Triazole-3-Sulfonamide No suppilers available for the product. |
| Name | 5-(4-Aminophenyl)-1H-1,2,4-Triazole-3-Sulfonamide |
|---|---|
| Synonyms | Brn 2987543; 1H-1,2,4-Triazole, 5-(P-Aminophenyl)-3-(Aminosulfonyl)-; 1H-1,2,4-Triazole-3-Sulfonamide, 5-(P-Aminophenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9N5O2S |
| Molecular Weight | 239.25 |
| CAS Registry Number | 4922-94-5 |
| SMILES | C2=C(C1=N[NH]C(=N1)[S](=O)(=O)N)C=CC(=C2)N |
| InChI | 1S/C8H9N5O2S/c9-6-3-1-5(2-4-6)7-11-8(13-12-7)16(10,14)15/h1-4H,9H2,(H2,10,14,15)(H,11,12,13) |
| InChIKey | ATCMEODUEFPKIV-UHFFFAOYSA-N |
| Density | 1.587g/cm3 (Cal.) |
|---|---|
| Boiling point | 607.822°C at 760 mmHg (Cal.) |
| Flash point | 321.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(4-Aminophenyl)-1H-1,2,4-Triazole-3-Sulfonamide |