Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2,3-Dimethylbenzothiophene |
|---|---|
| Synonyms | 2,3-Dimethylbenzothiophene; Benzo(B)Thiophene, 2,3-Dimethyl-; Inchi=1/C10h10s/C1-7-8(2)11-10-6-4-3-5-9(7)10/H3-6H,1-2H |
| Molecular Structure |  |
| Molecular Formula | C10H10S |
| Molecular Weight | 162.25 |
| CAS Registry Number | 4923-91-5 |
| SMILES | C1=CC2=C(C=C1)SC(=C2C)C |
| InChI | 1S/C10H10S/c1-7-8(2)11-10-6-4-3-5-9(7)10/h3-6H,1-2H3 |
| InChIKey | ACHMHHCOSAKQSS-UHFFFAOYSA-N |
| Density | 1.115g/cm3 (Cal.) |
|---|---|
| Boiling point | 268.432°C at 760 mmHg (Cal.) |
| Flash point | 84.463°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dimethylbenzothiophene |