Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 7-Fluoro-1,2,4-Benzotriazine 1-Oxide |
|---|---|
| Synonyms | 7-fluorobenzo[e][1,2,4]triazine 1-oxide |
| Molecular Structure |  |
| Molecular Formula | C7H4FN3O |
| Molecular Weight | 165.12 |
| CAS Registry Number | 492469-53-1 |
| SMILES | c1cc2c(cc1F)[n+](ncn2)[O-] |
| InChI | 1S/C7H4FN3O/c8-5-1-2-6-7(3-5)11(12)10-4-9-6/h1-4H |
| InChIKey | KEFCJIGOXJCNLI-UHFFFAOYSA-N |
| Density | 1.521g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.26°C at 760 mmHg (Cal.) |
| Flash point | 165.027°C (Cal.) |
| Refractive index | 1.669 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Fluoro-1,2,4-Benzotriazine 1-Oxide |