| CAS: 495-70-5 Product: Meprylcaine No suppliers available. |
| Name | Meprylcaine |
|---|---|
| Synonyms | [2-methyl-2-(propylamino)propyl] benzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.32 |
| CAS Registry Number | 495-70-5 |
| SMILES | CCCNC(C)(C)COC(=O)C1=CC=CC=C1 |
| Solubility | 572.1 mg/L (25 °C water) |
|---|---|
| Density | 1.0±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.502, Calc.* |
| Melting point | 83.55 °C |
| Boiling Point | 312.66 °C, 329.5±25.0 °C (760 mmHg), Calc.* |
| Flash Point | 153.1±23.2 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Meprylcaine |