Online Database of Chemicals from Around the World
|
CAS#: 4957-16-8 Product: Bis(2,4,5-Trimethylphenyl)Methane No suppilers available for the product. |
| Name | Bis(2,4,5-Trimethylphenyl)Methane |
|---|---|
| Synonyms | 1,2,4-Trimethyl-5-(2,4,5-Trimethylbenzyl)Benzene; 4-05-00-01994 (Beilstein Handbook Reference); Brn 1962956 |
| Molecular Structure |  |
| Molecular Formula | C19H24 |
| Molecular Weight | 252.40 |
| CAS Registry Number | 4957-16-8 |
| SMILES | C1=C(C(=CC(=C1CC2=CC(=C(C=C2C)C)C)C)C)C |
| InChI | 1S/C19H24/c1-12-7-16(5)18(9-14(12)3)11-19-10-15(4)13(2)8-17(19)6/h7-10H,11H2,1-6H3 |
| InChIKey | RYRHSRXGIHUJNJ-UHFFFAOYSA-N |
| Density | 0.947g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.268°C at 760 mmHg (Cal.) |
| Flash point | 193.996°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(2,4,5-Trimethylphenyl)Methane |