Online Database of Chemicals from Around the World
| Name | 2,2'-Oxydibenzaldehyde |
|---|---|
| Synonyms | 2,2-Diformyldiphenyl Ether; Bis(2-formylphenyl) Ether; Bis(2-Formylphenyl)ether |
| Molecular Structure |  |
| Molecular Formula | C14H10O3 |
| Molecular Weight | 226.23 |
| CAS Registry Number | 49590-51-4 |
| SMILES | O=Cc2c(Oc1ccccc1C=O)cccc2 |
| InChI | 1S/C14H10O3/c15-9-11-5-1-3-7-13(11)17-14-8-4-2-6-12(14)10-16/h1-10H |
| InChIKey | LMJZLKFWMQOYKU-UHFFFAOYSA-N |
| Density | 1.234g/cm3 (Cal.) |
|---|---|
| Melting point | 78°C (Expl.) |
| Boiling point | 349.024°C at 760 mmHg (Cal.) |
| Flash point | 154.399°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,2'-Oxydibenzaldehyde |
