|
CAS#: 49619-43-4 Product: 2-Chlorobenzoic Anhydride No suppilers available for the product. |
| Name | 2-Chlorobenzoic Anhydride |
|---|---|
| Synonyms | 2,2'-Dichlorobenzoic anhydride; 2-Chlorophenyl anhydride; 2-Chlorophenyl anhydride # |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8Cl2O3 |
| Molecular Weight | 295.12 |
| CAS Registry Number | 49619-43-4 |
| SMILES | O=C(OC(=O)c1ccccc1Cl)c2ccccc2Cl |
| InChI | 1S/C14H8Cl2O3/c15-11-7-3-1-5-9(11)13(17)19-14(18)10-6-2-4-8-12(10)16/h1-8H |
| InChIKey | OLENANGIJWDOPG-UHFFFAOYSA-N |
| Density | 1.401g/cm3 (Cal.) |
|---|---|
| Boiling point | 438.55°C at 760 mmHg (Cal.) |
| Flash point | 182.265°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chlorobenzoic Anhydride |