Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-(7-Azabicyclo[4.1.0]Hept-7-Yl)-2,2,2-Trifluoroethanone |
|---|---|
| Synonyms | 1-(7-azabicyclo[4.1.0]heptan-7-yl)-2,2,2-trifluoroethanone |
| Molecular Structure | ![CAS#: 496941-74-3， 1-(7-Azabicyclo[4.1.0]Hept-7-Yl)-2,2,2-Trifluoroethanone](/moreStructures/496941-74-3.gif) |
| Molecular Formula | C8H10F3NO |
| Molecular Weight | 193.17 |
| CAS Registry Number | 496941-74-3 |
| SMILES | C1CCC2C(C1)N2C(=O)C(F)(F)F |
| InChI | 1S/C8H10F3NO/c9-8(10,11)7(13)12-5-3-1-2-4-6(5)12/h5-6H,1-4H2 |
| InChIKey | PMIKZBAQVXPRLS-UHFFFAOYSA-N |
| Density | 1.342g/cm3 (Cal.) |
|---|---|
| Boiling point | 270.267°C at 760 mmHg (Cal.) |
| Flash point | 117.253°C (Cal.) |
| Refractive index | 1.454 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(7-Azabicyclo[4.1.0]Hept-7-Yl)-2,2,2-Trifluoroethanone |