Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl 2-[(2,2-Dimethylpropanoyl)Amino]Acrylate |
|---|---|
| Synonyms | methyl 2-pivalamidoacrylate |
| Molecular Structure | ![CAS#: 498573-02-7， Methyl 2-[(2,2-Dimethylpropanoyl)Amino]Acrylate](/moreStructures/498573-02-7.gif) |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 |
| CAS Registry Number | 498573-02-7 |
| SMILES | CC(C)(C)C(=O)NC(=C)C(=O)OC |
| InChI | 1S/C9H15NO3/c1-6(7(11)13-5)10-8(12)9(2,3)4/h1H2,2-5H3,(H,10,12) |
| InChIKey | VTCADMVMXGZZMZ-UHFFFAOYSA-N |
| Density | 1.021g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.784°C at 760 mmHg (Cal.) |
| Flash point | 151.434°C (Cal.) |
| Refractive index | 1.449 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-[(2,2-Dimethylpropanoyl)Amino]Acrylate |