Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | (1alpha,2beta,5alpha)-5-(Isopropyl)-2-Methylcyclohexan-1-Ol |
|---|---|
| Synonyms | (1R,2R,5R)-5-Isopropyl-2-Methyl-Cyclohexan-1-Ol; (1R,2R,5R)-5-Isopropyl-2-Methyl-1-Cyclohexanol; (1R,2R,5R)-2-Methyl-5-Propan-2-Yl-Cyclohexan-1-Ol |
| Molecular Structure |  |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 |
| CAS Registry Number | 499-69-4 |
| EINECS | 207-885-4 |
| FEMA | 3562 |
| SMILES | [C@@H]1(C[C@H]([C@@H](CC1)C)O)C(C)C |
| InChI | 1S/C10H20O/c1-7(2)9-5-4-8(3)10(11)6-9/h7-11H,4-6H2,1-3H3/t8-,9-,10-/m1/s1 |
| InChIKey | ULJXKUJMXIVDOY-OPRDCNLKSA-N |
| Density | 0.89g/cm3 (Cal.) |
|---|---|
| Boiling point | 221.999°C at 760 mmHg (Cal.) |
| Flash point | 86.726°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1alpha,2beta,5alpha)-5-(Isopropyl)-2-Methylcyclohexan-1-Ol |