| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Fluorochem Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| PepTech Corporation | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (781) 273-5400 | |||
![]() |
service@peptechcorp.com | |||
| Chemical manufacturer | ||||
| Watanabe Chemical Ind., Ltd. | Japan | Inquire | ||
|---|---|---|---|---|
![]() |
+81 (82) 231-0540 | |||
![]() |
inquiry@watanabechem.co.jp | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> BOC-amino acid |
|---|---|
| Name | 3-({[(2-Methyl-2-Propanyl)Oxy]Carbonyl}Amino)-3-(4-Nitrophenyl)Propanoic Acid |
| Synonyms | (R)-3-Boc-Amino-3-(4-nitrophenyl)propionic acid; Boc-(S)-3-amino-3-(4-nitrophenyl)propionic acid; Boc-R-3-Amino-3-(4-nitro-phenyl)-propionic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18N2O6 |
| Molecular Weight | 310.30 |
| CAS Registry Number | 499995-73-2 |
| SMILES | [O-][N+](=O)c1ccc(cc1)C(NC(=O)OC(C)(C)C)CC(=O)O |
| InChI | 1S/C14H18N2O6/c1-14(2,3)22-13(19)15-11(8-12(17)18)9-4-6-10(7-5-9)16(20)21/h4-7,11H,8H2,1-3H3,(H,15,19)(H,17,18) |
| InChIKey | JLVLDNCAYKCLCI-UHFFFAOYSA-N |
| Density | 1.288g/cm3 (Cal.) |
|---|---|
| Melting point | 146-148°C (Expl.) |
| Boiling point | 502.97°C at 760 mmHg (Cal.) |
| Flash point | 257.987°C (Cal.) |
| Refractive index | 1.553 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-({[(2-Methyl-2-Propanyl)Oxy]Carbonyl}Amino)-3-(4-Nitrophenyl)Propanoic Acid |