| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | trans-4-Acetylcyclohexanecarboxylic acid |
|---|---|
| Synonyms | (1r,4r)-4-acetylcyclohexanecarboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 |
| CAS Registry Number | 500688-80-2 |
| SMILES | O=C(C)[C@@H]1CC[C@H](CC1)C(O)=O |
| InChI | 1S/C9H14O3/c1-6(10)7-2-4-8(5-3-7)9(11)12/h7-8H,2-5H2,1H3,(H,11,12)/t7-,8- |
| InChIKey | ZRKFRUWMDLOXNB-ZKCHVHJHSA-N |
| Density | 1.135g/cm3 (Cal.) |
|---|---|
| Boiling point | 314.465°C at 760 mmHg (Cal.) |
| Flash point | 158.202°C (Cal.) |
| Refractive index | 1.485 (Cal.) |
| (1) | J. M. Newman, H. W. Thompson and R. A. Lalancette. trans-4-Acetylcyclohexanecarboxylic acid and (\pm)-trans-2-acetylcyclohexanecarboxylic acid: hydrogen-bonding patterns in two isomeric keto acids, Acta Cryst. (2002). C58, o693-o696 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for trans-4-Acetylcyclohexanecarboxylic acid |