Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl 4-{[(2Z)-2-Amino-2-Iminoethyl]Amino}Benzoate |
|---|---|
| Synonyms | methyl 4-((2-amino-2-iminoethyl)amino)benzoate; NSC153338 |
| Molecular Structure | ![CAS#: 500694-85-9， Methyl 4-{[(2Z)-2-Amino-2-Iminoethyl]Amino}Benzoate](/moreStructures/500694-85-9.gif) |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 |
| CAS Registry Number | 500694-85-9 |
| SMILES | O=C(OC)c1ccc(NCC(=[N@H])N)cc1 |
| InChI | 1S/C10H13N3O2/c1-15-10(14)7-2-4-8(5-3-7)13-6-9(11)12/h2-5,13H,6H2,1H3,(H3,11,12) |
| InChIKey | OSBFMXJKCBWPPK-UHFFFAOYSA-N |
| Density | 1.246g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.895°C at 760 mmHg (Cal.) |
| Flash point | 188.997°C (Cal.) |
| Refractive index | 1.576 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 4-{[(2Z)-2-Amino-2-Iminoethyl]Amino}Benzoate |