Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Ethyl-2-Biphenylcarboxylic Acid |
|---|---|
| Synonyms | 3-ethyl-[1,1'-biphenyl]-2-carboxylic acid |
| Molecular Structure |  |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27 |
| CAS Registry Number | 500905-09-9 |
| SMILES | CCc1cccc(c1C(=O)O)c2ccccc2 |
| InChI | 1S/C15H14O2/c1-2-11-9-6-10-13(14(11)15(16)17)12-7-4-3-5-8-12/h3-10H,2H2,1H3,(H,16,17) |
| InChIKey | BPWOBJGGXZJIKR-UHFFFAOYSA-N |
| Density | 1.131g/cm3 (Cal.) |
|---|---|
| Boiling point | 346.107°C at 760 mmHg (Cal.) |
| Flash point | 164.168°C (Cal.) |
| Refractive index | 1.588 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Ethyl-2-Biphenylcarboxylic Acid |